7α-Methylestradiol |
|
| Other names | 7α-Methyl-E2; 7α-Me-E2; 7α-Methylestra-1,3,5(10)-triene-3,17β-diol |
|---|
| Drug class | Estrogen |
|---|
|
(7R,8R,9S,13S,14S,17S)-7,13-Dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEMBL | |
|---|
|
| Formula | C19H26O2 |
|---|
| Molar mass | 286.415 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
[H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=CC=C(O)C=C3C[C@@H](C)[C@@]21[H]
|
InChI=1/C19H26O2/c1-11-9-12-10-13(20)3-4-14(12)15-7-8-19(2)16(18(11)15)5-6-17(19)21/h3-4,10-11,15-18,20-21H,5-9H2,1-2H3/t11-,15-,16+,17+,18-,19+/s2 Key:DXWWYJWUFULMAP-BQXDHOISNA-N
|
7α-Methylestradiol (7α-Me-E2), also known as 7α-methylestra-1,3,5(10)-triene-3,17β-diol, is a synthetic estrogen and an active metabolite of the androgen/anabolic steroid Trestolone. It is considered to be responsible for the estrogenic activity of trestolone. The compound shows about higher affinity for the androgen receptor than estradiol.
Relative affinities (%) of 7α-methylestradiol and related steroids
| Compound |
PRTooltip Progesterone receptor |
ARTooltip Androgen receptor |
ERTooltip Estrogen receptor |
GRTooltip Glucocorticoid receptor |
MRTooltip Mineralocorticoid receptor |
SHBGTooltip Sex hormone-binding globulin |
CBGTooltip Corticosteroid binding globulin
|
| Estradiol |
2.6 |
7.9 |
100 |
0.6 |
0.13 |
8.7 |
<0.1
|
| 7α-Methylestradiol |
1–3 |
15–25 |
101 |
<1 |
<1 |
? |
?
|
| Trestolone |
50–75 |
100–125 |
? |
<1 |
? |
? |
?
|
| Values are percentages (%). Reference ligands (100%) were progesterone for the PRTooltip progesterone receptor, testosterone for the ARTooltip androgen receptor, E2 for the ERTooltip estrogen receptor, DEXATooltip dexamethasone for the GRTooltip glucocorticoid receptor, aldosterone for the MRTooltip mineralocorticoid receptor, DHTTooltip dihydrotestosterone for SHBGTooltip sex hormone-binding globulin, and cortisol for CBGTooltip Corticosteroid-binding globulin.
|