5α-Dihydronormethandrone |
|
| Other names | 5α-DHNMT; RU-575; 17α-Methyl-4,5α-dihydro-19-nortestosterone; 17α-Methyl-5α-estran-17β-ol-3-one |
|---|
|
(5S,8R,9R,10S,13S,14S,17S)-17-Hydroxy-13,17-dimethyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-one
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
|
| Formula | C19H30O2 |
|---|
| Molar mass | 290.447 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CC[C@@H]4[C@@H]3CCC(=O)C4
|
InChI=MDXRCPMWSFWIEZ-MOVWYJJTSA-N Key:1S/C19H30O2/c1-18-9-7-15-14-6-4-13(20)11-12(14)3-5-16(15)17(18)8-10-19(18,2)21/h12,14-17,21H,3-11H2,1-2H3/t12-,14-,15+,16+,17-,18-,19-/m0/s1
|
5α-Dihydronormethandrone (5α-DHNMT; developmental code name RU-575), also known as 17α-methyl-4,5α-dihydro-19-nortestosterone or as 17α-methyl-5α-estran-17β-ol-3-one, is an androgen/anabolic steroid and a likely metabolite of normethandrone formed by 5α-reductase. Analogously to nandrolone and its 5α-reduced metabolite 5α-dihydronandrolone, 5α-DHNMT shows reduced affinity for the androgen receptor relative to normethandrone. Its affinity for the androgen receptor is specifically about 33 to 60% of that of normethandrone.
Relative affinities (%) of normethandrone and metabolites
| Compound |
PRTooltip Progesterone receptor |
ARTooltip Androgen receptor |
ERTooltip Estrogen receptor |
GRTooltip Glucocorticoid receptor |
MRTooltip Mineralocorticoid receptor |
SHBGTooltip Sex hormone-binding globulin |
CBGTooltip Corticosteroid binding globulin
|
| Normethandrone |
75–125 |
125–150 |
<1 |
1–5 |
<1 |
? |
?
|
| 5α-Dihydronormethandrone |
15–25 |
50–75 |
? |
<1 |
? |
? |
?
|
| Notes: Values are percentages (%). Reference ligands (100%) were progesterone for the PRTooltip progesterone receptor, testosterone for the ARTooltip androgen receptor, estradiol for the ERTooltip estrogen receptor, dexamethasone for the GRTooltip glucocorticoid receptor, and aldosterone for the MRTooltip mineralocorticoid receptor. Sources: See template.
|