Zizyberenalic acid

Zizyberenalic acid
Names
	IUPAC name (1R,2R,5S,8R,14S,18S)-15-formyl-1,2,14,17,17-pentamethyl-8-prop-1-en-2-ylpentacyclo[11.7.0.02,10.05,9.014,18]icos-15-ene-5-carboxylic acid
Identifiers
3D model (JSmol)	Interactive image;
ChemSpider	13100081;
PubChem CID	15958448;
	InChI InChI=1S/C30H44O3/c1-18(2)20-10-13-30(25(32)33)15-14-27(5)21(24(20)30)8-9-23-28(27,6)12-11-22-26(3,4)16-19(17-31)29(22,23)7/h16-17,20-24H,1,8-15H2,2-7H3,(H,32,33)/t20-,21?,22-,23?,24?,27+,28+,29-,30-/m0/s1 Key: GUPQNHIGLNUBOG-HYYJCJJOSA-N ;
	SMILES CC(=C)[C@@H]1CC[C@]2(C1C3CCC4[C@]([C@@]3(CC2)C)(CC[C@@H]5[C@@]4(C(=CC5(C)C)C=O)C)C)C(=O)O;
Properties
Chemical formula	C30H44O3
Molar mass	452.679 g·mol−1
Solubility in water	soluble
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). (what is ?) Infobox references

Zizyberenalic acid is a naturally occurring organic compound classified as a triterpenoid—a subclass of terpenoids notable for their complex multi-ring structures. The acid has the molecular formula C₃₀H₄₄O₃. The compound is characterized by a pentacyclic ring system with multiple methyl groups and a carboxylic acid functional group, as well as an aldehyde moiety.