Upamostat |
|
| Legal status |
|
|---|
|
ethyl 4-[(2S)-3-[3-[(E)-N'-hydroxycarbamimidoyl]phenyl]-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoyl]piperazine-1-carboxylate
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| DrugBank | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
|
| Formula | C32H47N5O6S |
|---|
| Molar mass | 629.82 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
CCOC(=O)N1CCN(CC1)C(=O)[C@H](CC2=CC(=CC=C2)/C(=N\O)/N)NS(=O)(=O)C3=C(C=C(C=C3C(C)C)C(C)C)C(C)C
|
InChI=1S/C32H47N5O6S/c1-8-43-32(39)37-14-12-36(13-15-37)31(38)28(17-23-10-9-11-24(16-23)30(33)34-40)35-44(41,42)29-26(21(4)5)18-25(20(2)3)19-27(29)22(6)7/h9-11,16,18-22,28,35,40H,8,12-15,17H2,1-7H3,(H2,33,34)/t28-/m0/s1 Key:HUASEDVYRABWCV-NDEPHWFRSA-N
|
Upamostat (WX-671, Mesupron) is a drug which acts as an inhibitor of the serine protease enzyme urokinase. It is under development as a potential treatment agent for pancreatic cancer, acting to inhibit tumour metastasis.