Trisporic acid

Trisporic acid
	Trisporic acid A
	Trisporic acid B
	Trisporic acid C
Identifiers
CAS Number	A: 161023-29-6; B: 26057-02-3; C: 26055-09-4;
3D model (JSmol)	A: Interactive image; B: Interactive image; C: Interactive image;
ChEBI	CHEBI:91017;
ChemSpider	B: 109121640; C: 8645830;
PubChem CID	A: 90471808; B: 90470632; C: 101306749;
	InChI A: InChI=1S/C18H26O3/c1-5-6-7-8-13(2)9-10-15-14(3)16(19)11-12-18(15,4)17(20)21/h8-10H,5-7,11-12H2,1-4H3,(H,20,21)/b10-9+,13-8+/t18-/m0/s1 Key: OSQWPUQNCKZCOA-WVPSHWIESA-N; B: InChI=1S/C18H24O4/c1-12(6-5-7-13(2)19)8-9-15-14(3)16(20)10-11-18(15,4)17(21)22/h6,8-9H,5,7,10-11H2,1-4H3,(H,21,22)/b9-8+,12-6+/t18-/m0/s1 Key: AUOKEERYXZUYBN-YEOBPPCSSA-N; C: InChI=1S/C18H26O4/c1-12(6-5-7-13(2)19)8-9-15-14(3)16(20)10-11-18(15,4)17(21)22/h6,8-9,13,19H,5,7,10-11H2,1-4H3,(H,21,22)/b9-8+,12-6+/t13-,18+/m1/s1 Key: JYCOWXFWTZCULN-KSUWSPNXSA-N;
	SMILES A: CCCC/C=C(\C)/C=C/C1=C(C(=O)CC[C@]1(C)C(=O)O)C; B: CC1=C([C@@](CCC1=O)(C)C(=O)O)/C=C/C(=C/CCC(=O)C)/C; C: CC1=C([C@@](CCC1=O)(C)C(=O)O)/C=C/C(=C/CC[C@@H](C)O)/C;
Properties
Chemical formula	A: C18H26O3; B: C18H24O4; C: C18H26O4
Molar mass	A: 290.40 g/mol; B: 304.39 g/mol; C: 306.40 g/mol
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Trisporic acids (TSAs) are C-18 terpenoid compounds synthesized via β-carotene and retinol pathways in the zygomycetes. They are pheromone compound responsible for sexual differentiation in those fungal species. TSAs and related compounds make up the trisporoid group of chemicals.