TC OT 39 |
|
| ATC code | |
|---|
|
(2S)-N-[[4-[(4,10-dihydro-1-methylpyrazolo[3,4-b][1,5]benzodiazepin-5(1H)-yl)carbonyl]-2-methylphenyl]methyl]-2-[(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)thioxomethyl]-1-pyrrolidinecarboxamide
|
| CAS Number | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C32H40N8O2S |
|---|
| Molar mass | 600.79 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
Cc1cc(ccc1CNC(=O)N2CCC[C@H]2C(=S)N3CCCN(CC3)C)C(=O)N4Cc5cnn(c5Nc6c4cccc6)C
|
InChI=1S/C32H40N8O2S/c1-22-18-23(30(41)40-21-25-20-34-37(3)29(25)35-26-8-4-5-9-27(26)40)11-12-24(22)19-33-32(42)39-15-6-10-28(39)31(43)38-14-7-13-36(2)16-17-38/h4-5,8-9,11-12,18,20,28,35H,6-7,10,13-17,19,21H2,1-3H3,(H,33,42)/t28-/m0/s1 Key:KSNHHKZYKYNBEI-NDEPHWFRSA-N
|
TC OT 39 is a non-peptide partial agonist of the oxytocin and vasopressin V2 receptors (Ki = 147 nM and >1000 nM, respectively) and antagonist of the vasopressin V1A receptor (Ki = 330 nM).