Promin |
|
|
| Other names | Sodium glucosulfone, Aceprosol, Promanide, Tasmin, Sulfona P |
|---|
|
2,3,4,5,6-pentahydroxy-1-[4-[4-[(2,3,4,5,6-pentahydroxy-1-sulfohexyl)amino]phenyl]sulfonylanilino]hexane-1-sulfonic acid
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C24H36N2O18S3 |
|---|
| Molar mass | 736.73 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
[Na+].[Na+].[O-]S(=O)(=O)[C@H](Nc1ccc(cc1)S(=O)(=O)c2ccc(N[C@@H](S([O-])(=O)=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc2)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO
|
InChI=1S/C24H36N2O18S3.2Na/c27-9-15(29)17(31)19(33)21(35)23(46(39,40)41)25-11-1-5-13(6-2-11)45(37,38)14-7-3-12(4-8-14)26-24(47(42,43)44)22(36)20(34)18(32)16(30)10-28;;/h1-8,15-36H,9-10H2,(H,39,40,41)(H,42,43,44);;/q;2*+1/p-2/t15-,16-,17-,18-,19+,20+,21-,22-,23+,24+;;/m1../s1 N Key:NLLGJEMIZSAJFN-XRAGNMTMSA-L N
|
| NY (what is this?) (verify) |
Promin, or sodium glucosulfone is a sulfone drug that was investigated for the treatment of malaria, tuberculosis and leprosy. It is broken down in the body to dapsone, which is the therapeutic form.