Olivetoric acid

Olivetoric acid
Names
	IUPAC name 4-[2,4-dihydroxy-6-(2-oxoheptyl)benzoyl]oxy-2-hydroxy-6-pentylbenzoic acid
	Other names Olivetoric acid
Identifiers
CAS Number	491-47-4 ;
3D model (JSmol)	Interactive image;
ChEBI	CHEBI:144183 ;
ChEMBL	ChEMBL3770253 ;
ChemSpider	513972 ;
PubChem CID	591238;
CompTox Dashboard (EPA)	DTXSID101316863 ;
	InChI InChI=1S/C26H32O8/c1-3-5-7-9-16-13-20(15-22(30)23(16)25(31)32)34-26(33)24-17(12-19(28)14-21(24)29)11-18(27)10-8-6-4-2/h12-15,28-30H,3-11H2,1-2H3,(H,31,32) Key: VZPLPGICHZXOCQ-UHFFFAOYSA-N ;
	SMILES CCCCCC1=C(C(=CC(=C1)OC(=O)C2=C(C=C(C=C2O)O)CC(=O)CCCCC)O)C(=O)O;
Properties
Chemical formula	C26H32O8
Molar mass	472.534 g·mol−1
Melting point	151 °C (304 °F; 424 K)
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Olivetoric acid is an organic compound belonging to the chemical class known as depsides. A secondary metabolite of various lichen species, it has been investigated for its various biological activities.