Linoleic acid
| Names | |
|---|---|
| Preferred IUPAC name
(9Z,12Z)-Octadeca-9,12-dienoic acid | |
| Other names
cis,cis-9,12-Octadecadienoic acid
C18:2 (Lipid numbers) | |
| Identifiers | |
3D model (JSmol)
|
|
| 1727101 | |
| ChEBI | |
| ChEMBL | |
| ChemSpider | |
| DrugBank | |
| ECHA InfoCard | 100.000.428 |
| EC Number |
|
| 57557 | |
| KEGG | |
PubChem CID
|
|
| UNII | |
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C18H32O2 | |
| Molar mass | 280.452 g·mol−1 |
| Appearance | Colorless oil |
| Density | 0.9 g/cm3 |
| Melting point | −12 °C (10 °F) −6.9 °C (19.6 °F) −5 °C (23 °F) |
| Boiling point | 229 °C (444 °F) at 16 mmHg 230 °C (446 °F) at 21 mbar 230 °C (446 °F) at 16 mmHg |
| 0.139 mg/L | |
| Vapor pressure | 16 Torr at 229 °C |
| Acidity (pKa) | 4.77 at 25°C |
| Hazards | |
| NFPA 704 (fire diamond) | |
| Flash point | 112 °C (234 °F) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
| |
Linoleic acid (LA) is an organic compound with the formula CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH. Both alkene groups (−CH=CH−) are cis. It is a fatty acid sometimes denoted 18:2 (n−6) or 18:2 cis-9,12. A linoleate is a salt or ester of this acid.
Linoleic acid is a polyunsaturated, omega−6 fatty acid. It is a colorless liquid that is virtually insoluble in water but soluble in many organic solvents. It typically occurs in nature as a triglyceride (ester of glycerin) rather than as a free fatty acid. It is one of two essential fatty acids for humans, who must obtain it through their diet, and the most essential, because the body uses it as a base to make the others.
The word "linoleic" derives from Latin linum 'flax' and oleum 'oil', reflecting the fact that it was first isolated from linseed oil.