Indanol

Indanol
Identifiers
CAS Number	1: 6351-10-6 racemic; 2: 4254-29-9; 4: 1641-41-4; 5: 1470-94-6;
3D model (JSmol)	1: Interactive image; 2: Interactive image; 4: Interactive image; 5: Interactive image;
Beilstein Reference	1:2042960,
ChEBI	1: CHEBI:16697; 5: CHEBI:59311;
ChEMBL	1: ChEMBL4564909; 5: ChEMBL3218378;
ChemSpider	1: 21394; 2: 70326; 4: 66840; 5: 14390;
EC Number	1: 228-755-3; 2: 224-230-8; 4: 216-691-9; 5: 216-006-3;
KEGG	1: C01710;
PubChem CID	1: 22819; 2: 77936; 4: 74233; 5: 15118;
UNII	1: LHG5BD7LOR; 2: B77NA7SM29; 4: 7PJT17BE05; 5: 9Z94H6F15T;
CompTox Dashboard (EPA)	4: DTXSID00167708; 5: DTXSID0051732;
	InChI 1: InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2 Key: YIAPLDFPUUJILH-UHFFFAOYSA-N; 2: InChI=1S/C9H10O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2 Key: KMGCKSAIIHOKCX-UHFFFAOYSA-N; 4: InChI=1S/C9H10O/c10-9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2 Key: DPHNJPUOMLRELT-UHFFFAOYSA-N; 5: InChI=1S/C9H10O/c10-9-5-4-7-2-1-3-8(7)6-9/h4-6,10H,1-3H2 Key: PEHSSTUGJUBZBI-UHFFFAOYSA-N;
	SMILES 1: OC1CCc2ccccc21; 2: OC1Cc2ccccc2C1; 4: Oc1cccc2c1CCC2; 5: Oc1ccc2c(c1)CCC2;
Properties
Chemical formula	C9H10O
Molar mass	134.178 g·mol−1
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Indanols are a class of organic compounds, some of which are useful in medicine or industry. They are hydroxy derivatives of the parent compound called indane (also known as indan).