Hexestrol dipropionate |
|
| Other names | Hexestrol 4,4'-dipropionate |
|---|
|
[4-[4-(4-propanoyloxyphenyl)hexan-3-yl]phenyl] propanoate
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C24H30O4 |
|---|
| Molar mass | 382.500 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
CCC(C1=CC=C(C=C1)OC(=O)CC)C(CC)C2=CC=C(C=C2)OC(=O)CC
|
InChI=1S/C24H30O4/c1-5-21(17-9-13-19(14-10-17)27-23(25)7-3)22(6-2)18-11-15-20(16-12-18)28-24(26)8-4/h9-16,21-22H,5-8H2,1-4H3 Key:HZLYMVNJKHJFRO-UHFFFAOYSA-N
|
Hexestrol dipropionate (brand name Hexanoestrol, Retalon Oleosum), or hexestrol dipropanoate, is a synthetic, nonsteroidal estrogen of the stilbestrol group related to diethylstilbestrol. It is an ester of hexestrol, and has been known since at least 1931. The drug has been used in the past to inhibit lactation in women.