Eicosadienoic acid

Eicosadienoic acid
Names
	IUPAC name (11Z,14Z)-icosa-11,14-dienoic acid
Identifiers
CAS Number	E/Z unspec: 2091-39-6;
3D model (JSmol)	Interactive image;
ChEBI	CHEBI:73731;
ChEMBL	ChEMBL464983;
ChemSpider	9658485;
KEGG	C16525;
PubChem CID	6439848;
CompTox Dashboard (EPA)	DTXSID20912353;
	InChI InChI=1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10H,2-5,8,11-19H2,1H3,(H,21,22)/b7-6-,10-9- Key: XSXIVVZCUAHUJO-HZJYTTRNSA-N;
	SMILES CCCCCC=CCC=CCCCCCCCCCC(=O)O;
Properties
Chemical formula	C20H36O2
Molar mass	308.506 g·mol−1
Appearance	colorless liquid
Density	0.9 g/cm³
Melting point	148.9 °C (300.0 °F; 422.0 K)
Boiling point	198 °C (388 °F; 471 K)
Solubility in water	insoluble
Hazards
Flash point	297.4 °C
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Eicosadienoic acid (EDA) is a polyunsaturated omega-6 fatty acid with the chemical formula C₂₀H₃₆O₂. It is classified as a 20-carbon fatty acid with two double bonds, specifically at the 11th and 14th positions (denoted as 20:2(ω-6)). EDA is a minor fatty acid found in certain animal and plant sources and plays a role in lipid metabolism.