Caleicine

Caleicine
Legal status
Legal status	In general: uncontrolled;
Identifiers
CAS Number	140384-72-1;
PubChem CID	21726659;
ChemSpider	10315583;
ChEMBL	ChEMBL455625;
Chemical and physical data
Formula	C24H32O3
Molar mass	368.517 g·mol−1
3D model (JSmol)	Interactive image;
	SMILES OC1=CC=C(/C=C/C(O[C@H]2C(CC[C@]3(CCCC([C@]23[H])=C)C)C(C)C)=O)C=C1;
	InChI InChI=InChI=1S/C24H32O3/c1-16(2)20-13-15-24(4)14-5-6-17(3)22(24)23(20)27-21(26)12-9-18-7-10-19(25)11-8-18/h7-12,16,20,22-23,25H,3,5-6,13-15H2,1-2,4H3/b12-9+/t20?,22-,23+,24-/m1/s1; Key:IIZXOWSEQGPRRJ-ORWIVXHPSA-N;

Caleicine is a unique sesquiterpene compound found exclusively in Calea ternifolia, a Mexican flowering plant known for its potential psychoactive properties. This compound has garnered interest in the field of ethnopharmacology and natural product chemistry due to its putative role as a prodrug of eugenol, a potent GABA positive modulator.

Caleicine is the p-Coumaric ester of junenol and has no lactone moiety making it distinctly unique from the other sesquiterpene lactones in Calea ternifolia.