CP 47,497 |
|
| Legal status |
|
|---|
|
2-[(1S,3R)-3-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C21H34O2 |
|---|
| Molar mass | 318.501 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
(1S,3R): CCCCCCC(C)(C)c1ccc(c(c1)O)[C@H]2CCC[C@H](C2)O
(1R,3S): CCCCCCC(C)(C)c1ccc(c(c1)O)[C@@H]2CCC[C@@H](C2)O
|
(1S,3R): InChI=1S/C21H34O2/c1-4-5-6-7-13-21(2,3)17-11-12-19(20(23)15-17)16-9-8-10-18(22)14-16/h11-12,15-16,18,22-23H,4-10,13-14H2,1-3H3/t16-,18+/m0/s1 Key:ZWWRREXSUJTKNN-FUHWJXTLSA-N
(1R,3S): InChI=1S/C21H34O2/c1-4-5-6-7-13-21(2,3)17-11-12-19(20(23)15-17)16-9-8-10-18(22)14-16/h11-12,15-16,18,22-23H,4-10,13-14H2,1-3H3/t16-,18+/m1/s1 Key:ZWWRREXSUJTKNN-AEFFLSMTSA-N
|
CP 47,497 or (C7)-CP 47,497 is a cannabinoid receptor agonist drug, developed by Pfizer in the 1980s. It has analgesic effects and is used in scientific research. It is a potent CB1 agonist with a Kd of 2.1 nM.