AM-679 (FLAP inhibitor) |
|
3-(5-[(S)-1-acetyl-2,3-dihydro-1H-indol-2-ylmethoxy]-3-t-butylsulfanyl-1-[4-(5-methoxypyrimidin-2-yl)benzyl]-1H-indol-2-yl)-2,2-dimethylpropionic acid
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
|
| Formula | C40H44N4O5S |
|---|
| Molar mass | 692.88 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
n5cc(OC)cnc5-c6ccc(cc6)Cn(c1CC(C)(C)C(=O)O)c4ccc(cc4c1SC(C)(C)C)OCC3Cc2ccccc2N3C(=O)C
|
InChI=1S/C39H42N4O5S/c1-24(44)43-28(18-27-10-8-9-11-32(27)43)23-48-29-16-17-33-31(19-29)34(49-38(2,3)4)35(39(5,6)37(45)46)42(33)22-25-12-14-26(15-13-25)36-40-20-30(47-7)21-41-36/h8-17,19-21,28H,18,22-23H2,1-7H3,(H,45,46)/t28-/m0/s1 Y Key:XTSOSRWDZSKOSB-NDEPHWFRSA-N Y
|
| (verify) |
AM-679 is a drug which acts as a selective inhibitor of 5-Lipoxygenase-activating protein (FLAP). This protein is involved in the production of cysteinyl leukotrienes which are involved in inflammation, and AM-679 has anti-inflammatory effects in animal studies.