3-Methyl-3-octanol
| Names | |
|---|---|
| Preferred IUPAC name
3-Methyloctan-3-ol | |
| Other names
Amylethylmethylcarbinol
2-Ethyl-2-heptanol 3-Methyloctan-3-ol | |
| Identifiers | |
3D model (JSmol)
|
|
| ChemSpider | |
| ECHA InfoCard | 100.023.888 |
PubChem CID
|
|
| UNII | |
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C9H20O | |
| Molar mass | 144.2545 g/mol |
| Density | 0.822 g/mL |
| Boiling point | 127 °C (261 °F; 400 K) |
| Hazards | |
| Flash point | 73 °C (163 °F; 346 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
| |
3-Methyl-3-octanol (systematically named 3-methyloctan-3-ol) is an organic compound with the chemical formula CH3(CH2)4C(CH3)(CH2CH3)OH (also written as C
9H
20O). This simple tertiary alcohol is a clear colourless liquid under standard conditions, and is tasteless.
It is used in the food industry as a flavouring agent as it contributes to the flavour of roast beef. It is known to be biochemically produced by the Antrodia camphorata fungus. 3-Methyl-3-octanol is a chiral compound, with each isomer yielding a different flavour.