2,5-Hexanediol
| Names | |
|---|---|
| Preferred IUPAC name
Hexane-2,5-diol | |
| Identifiers | |
3D model (JSmol)
|
|
| ChEBI | |
| ChemSpider | |
| ECHA InfoCard | 100.019.010 |
| EC Number |
|
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C6H14O2 | |
| Molar mass | 118.176 g·mol−1 |
| Hazards | |
| GHS labelling:[1] | |
| Warning | |
| H302, H315, H319, H335 | |
| P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, P501 | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
| |
2,5-Hexanediol is an organic compound with the formula CH3CH(OH)CH2CH2CH(OH)CH3. It is both a glycol and a secondary alcohol. It is a colorless water-soluble viscous liquid. The chemical properties are well understood and have been extensively reported and studied. It has the IUPAC name of hexane-2,5-diol and the CAS Registry Number CAS 2935-44-6.